C12H15F2NO4 — CID 114496076
1-(2,5-difluoro-4-nitrophenoxy)-2,3-dimethylbutan-2-ol (PubChem CID 114496076) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-nitrophenoxy)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(2,5-difluoro-4-nitrophenoxy)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114496076 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-(2,5-difluoro-4-nitrophenoxy)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)COc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H15F2NO4/c1-7(2)12(3,16)6-19-11-5-8(13)10(15(17)18)4-9(11)14/h4-5,7,16H,6H2,1-3H3 |
| InChIKey | HWLDUIMMPRAYIT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|