C11H11F2NO4 — CID 64697339
4-(2,5-difluoro-4-nitrophenoxy)pentan-2-one (PubChem CID 64697339) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-nitrophenoxy)pentan-2-one.
| Compound Name | 4-(2,5-difluoro-4-nitrophenoxy)pentan-2-one |
|---|---|
| PubChem CID | 64697339 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-(2,5-difluoro-4-nitrophenoxy)pentan-2-one |
| SMILES | CC(=O)CC(C)Oc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H11F2NO4/c1-6(15)3-7(2)18-11-5-8(12)10(14(16)17)4-9(11)13/h4-5,7H,3H2,1-2H3 |
| InChIKey | QQNYMSGEYWLMRO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|