C10H11F2N3O4 — CID 55217418
2-(2,5-difluoro-4-nitrophenoxy)-N'-hydroxybutanimidamide (PubChem CID 55217418) has the molecular formula C10H11F2N3O4 and a molecular weight of 275.21 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-nitrophenoxy)-N'-hydroxybutanimidamide.
| Compound Name | 2-(2,5-difluoro-4-nitrophenoxy)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 55217418 |
| Molecular Formula | C10H11F2N3O4 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(2,5-difluoro-4-nitrophenoxy)-N'-hydroxybutanimidamide |
| SMILES | CCC(Oc1cc(F)c([N+](=O)[O-])cc1F)/C(N)=N/O |
| InChI | InChI=1S/C10H11F2N3O4/c1-2-8(10(13)14-16)19-9-4-5(11)7(15(17)18)3-6(9)12/h3-4,8,16H,2H2,1H3,(H2,13,14) |
| InChIKey | RMVHIDUXGIKBTD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|