C9H10F2N2O4 — CID 170828714
3-amino-1-(3,5-difluoro-4-nitrophenyl)propane-1,2-diol (PubChem CID 170828714) has the molecular formula C9H10F2N2O4 and a molecular weight of 248.19 g/mol. Its IUPAC name is 3-amino-1-(3,5-difluoro-4-nitrophenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(3,5-difluoro-4-nitrophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828714 |
| Molecular Formula | C9H10F2N2O4 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-amino-1-(3,5-difluoro-4-nitrophenyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cc(F)c([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C9H10F2N2O4/c10-5-1-4(9(15)7(14)3-12)2-6(11)8(5)13(16)17/h1-2,7,9,14-15H,3,12H2 |
| InChIKey | GPXZREFXZSXODE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|