C15H11ClF3N3O3S — CID 54696160
(Z)-3-[2-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]-3-hydroxy-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 54696160) has the molecular formula C15H11ClF3N3O3S and a molecular weight of 405.79 g/mol. Its IUPAC name is (Z)-3-[2-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]-3-hydroxy-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[2-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]-3-hydroxy-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54696160 |
| Molecular Formula | C15H11ClF3N3O3S |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (Z)-3-[2-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]-3-hydroxy-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C(\O)c1cccc(C(F)(F)F)c1NC(=O)CCl)Nc1nccs1 |
| InChI | InChI=1S/C15H11ClF3N3O3S/c16-7-12(25)21-13-8(2-1-3-9(13)15(17,18)19)10(23)6-11(24)22-14-20-4-5-26-14/h1-6,23H,7H2,(H,21,25)(H,20,22,24)/b10-6- |
| InChIKey | QMOUXZDFHHNANR-POHAHGRESA-N |
| XLogP | 3.88 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|