C14H7ClF3N3OS — CID 87189840
2-chloro-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)quinoline-8-carboxamide (PubChem CID 87189840) has the molecular formula C14H7ClF3N3OS and a molecular weight of 357.74 g/mol. Its IUPAC name is 2-chloro-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)quinoline-8-carboxamide.
| Compound Name | 2-chloro-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 87189840 |
| Molecular Formula | C14H7ClF3N3OS |
| Molecular Weight | 357.74 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-chloro-N-(1,3-thiazol-2-yl)-3-(trifluoromethyl)quinoline-8-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccc2cc(C(F)(F)F)c(Cl)nc12 |
| InChI | InChI=1S/C14H7ClF3N3OS/c15-11-9(14(16,17)18)6-7-2-1-3-8(10(7)20-11)12(22)21-13-19-4-5-23-13/h1-6H,(H,19,21,22) |
| InChIKey | JXAWDERZWJTPLS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|