C16H9ClF3N3O — CID 87189922
2-chloro-N-pyridin-2-yl-3-(trifluoromethyl)quinoline-8-carboxamide (PubChem CID 87189922) has the molecular formula C16H9ClF3N3O and a molecular weight of 351.72 g/mol. Its IUPAC name is 2-chloro-N-pyridin-2-yl-3-(trifluoromethyl)quinoline-8-carboxamide.
| Compound Name | 2-chloro-N-pyridin-2-yl-3-(trifluoromethyl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 87189922 |
| Molecular Formula | C16H9ClF3N3O |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-chloro-N-pyridin-2-yl-3-(trifluoromethyl)quinoline-8-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cccc2cc(C(F)(F)F)c(Cl)nc12 |
| InChI | InChI=1S/C16H9ClF3N3O/c17-14-11(16(18,19)20)8-9-4-3-5-10(13(9)23-14)15(24)22-12-6-1-2-7-21-12/h1-8H,(H,21,22,24) |
| InChIKey | BLZGBKXPCDBJDN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|