C21H14F3N3O — CID 58279245
N-pyridin-2-yl-2-[2-(trifluoromethyl)phenyl]-3H-indole-7-carboxamide (PubChem CID 58279245) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is N-pyridin-2-yl-2-[2-(trifluoromethyl)phenyl]-3H-indole-7-carboxamide.
| Compound Name | N-pyridin-2-yl-2-[2-(trifluoromethyl)phenyl]-3H-indole-7-carboxamide |
|---|---|
| PubChem CID | 58279245 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-pyridin-2-yl-2-[2-(trifluoromethyl)phenyl]-3H-indole-7-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cccc2c1N=C(c1ccccc1C(F)(F)F)C2 |
| InChI | InChI=1S/C21H14F3N3O/c22-21(23,24)16-9-2-1-7-14(16)17-12-13-6-5-8-15(19(13)26-17)20(28)27-18-10-3-4-11-25-18/h1-11H,12H2,(H,25,27,28) |
| InChIKey | YATCKVSPFOLNOS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |