About 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide
3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide (PubChem CID 161355859) has the molecular formula C22H16F2N4O
and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide.
Molecular Properties
| Compound Name | 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide |
| PubChem CID | 161355859 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide |
| SMILES | CC(F)(F)c1cccc(-c2cnc3cccc(C(=O)Nc4ccccn4)c3n2)c1 |
| InChI | InChI=1S/C22H16F2N4O/c1-22(23,24)15-7-4-6-14(12-15)18-13-26-17-9-5-8-16(20(17)27-18)21(29)28-19-10-2-3-11-25-19/h2-13H,1H3,(H,25,28,29) |
| InChIKey | XQJLVJXINIJJKJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide?
The IUPAC name of 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide (CID 161355859) is 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide.
What is the SMILES notation for 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide?
The canonical SMILES for 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide is CC(F)(F)c1cccc(-c2cnc3cccc(C(=O)Nc4ccccn4)c3n2)c1.
What is the InChIKey of 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide?
The InChIKey is XQJLVJXINIJJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N4O/c1-22(23,24)15-7-4-6-14(12-15)18-13-26-17-9-5-8-16(20(17)27-18)21(29)28-19-10-2-3-11-25-19/h2-13H,1H3,(H,25,28,29).
What are the key properties of 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide?
3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide has a molecular weight of 390.39 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,1-difluoroethyl)phenyl]-N-pyridin-2-ylquinoxaline-5-carboxamide is sourced from PubChem (CID 161355859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).