C21H13F3N4O2 — CID 58154775
N-pyridin-2-yl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-5-carboxamide (PubChem CID 58154775) has the molecular formula C21H13F3N4O2 and a molecular weight of 410.36 g/mol. Its IUPAC name is N-pyridin-2-yl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-5-carboxamide.
| Compound Name | N-pyridin-2-yl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 58154775 |
| Molecular Formula | C21H13F3N4O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-pyridin-2-yl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-5-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cccc2ncc(-c3cccc(OC(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C21H13F3N4O2/c22-21(23,24)30-14-6-3-5-13(11-14)17-12-26-16-8-4-7-15(19(16)27-17)20(29)28-18-9-1-2-10-25-18/h1-12H,(H,25,28,29) |
| InChIKey | VGABPANGKWMSEN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |