C22H14F3N3O4 — CID 135631507
7-hydroxy-N-pyridin-2-yl-2-[3-(trifluoromethoxy)phenyl]iminochromene-3-carboxamide (PubChem CID 135631507) has the molecular formula C22H14F3N3O4 and a molecular weight of 441.37 g/mol. Its IUPAC name is 7-hydroxy-N-pyridin-2-yl-2-[3-(trifluoromethoxy)phenyl]iminochromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-pyridin-2-yl-2-[3-(trifluoromethoxy)phenyl]iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 135631507 |
| Molecular Formula | C22H14F3N3O4 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 7-hydroxy-N-pyridin-2-yl-2-[3-(trifluoromethoxy)phenyl]iminochromene-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc2ccc(O)cc2o/c1=N\c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H14F3N3O4/c23-22(24,25)32-16-5-3-4-14(11-16)27-21-17(20(30)28-19-6-1-2-9-26-19)10-13-7-8-15(29)12-18(13)31-21/h1-12,29H,(H,26,28,30)/b27-21- |
| InChIKey | VOQBSVFIYQNCMJ-MEFGMAGPSA-N |
| XLogP | 4.92 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |