C23H17N3O5 — CID 135631486
methyl 3-[[7-hydroxy-3-(pyridin-2-ylcarbamoyl)chromen-2-ylidene]amino]benzoate (PubChem CID 135631486) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is methyl 3-[[7-hydroxy-3-(pyridin-2-ylcarbamoyl)chromen-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[7-hydroxy-3-(pyridin-2-ylcarbamoyl)chromen-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135631486 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 3-[[7-hydroxy-3-(pyridin-2-ylcarbamoyl)chromen-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1cccc(/N=c2\oc3cc(O)ccc3cc2C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C23H17N3O5/c1-30-23(29)15-5-4-6-16(11-15)25-22-18(21(28)26-20-7-2-3-10-24-20)12-14-8-9-17(27)13-19(14)31-22/h2-13,27H,1H3,(H,24,26,28)/b25-22- |
| InChIKey | QQTGBWKJNPSJKR-LVWGJNHUSA-N |
| XLogP | 3.80 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |