C18H14N2O5 — CID 135631698
methyl 3-[(3-carbamoyl-7-hydroxychromen-2-ylidene)amino]benzoate (PubChem CID 135631698) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is methyl 3-[(3-carbamoyl-7-hydroxychromen-2-ylidene)amino]benzoate.
| Compound Name | methyl 3-[(3-carbamoyl-7-hydroxychromen-2-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 135631698 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 3-[(3-carbamoyl-7-hydroxychromen-2-ylidene)amino]benzoate |
| SMILES | COC(=O)c1cccc(/N=c2\oc3cc(O)ccc3cc2C(N)=O)c1 |
| InChI | InChI=1S/C18H14N2O5/c1-24-18(23)11-3-2-4-12(7-11)20-17-14(16(19)22)8-10-5-6-13(21)9-15(10)25-17/h2-9,21H,1H3,(H2,19,22)/b20-17- |
| InChIKey | GHJJTTCUKVQYER-JZJYNLBNSA-N |
| XLogP | 2.26 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |