C18H17ClF3N3O3S — CID 88648034
2-chloro-N-[1,3-dioxo-1-(1,3-thiazol-2-ylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-yl]pentanamide (PubChem CID 88648034) has the molecular formula C18H17ClF3N3O3S and a molecular weight of 447.87 g/mol. Its IUPAC name is 2-chloro-N-[1,3-dioxo-1-(1,3-thiazol-2-ylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-yl]pentanamide.
| Compound Name | 2-chloro-N-[1,3-dioxo-1-(1,3-thiazol-2-ylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 88648034 |
| Molecular Formula | C18H17ClF3N3O3S |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-chloro-N-[1,3-dioxo-1-(1,3-thiazol-2-ylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-yl]pentanamide |
| SMILES | CCCC(Cl)C(=O)NC(C(=O)Nc1nccs1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3N3O3S/c1-2-4-12(19)15(27)24-13(16(28)25-17-23-7-8-29-17)14(26)10-5-3-6-11(9-10)18(20,21)22/h3,5-9,12-13H,2,4H2,1H3,(H,24,27)(H,23,25,28) |
| InChIKey | VHRJRODABNPLRU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|