C19H17IN4O — CID 6882697
N-[(E)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 6882697) has the molecular formula C19H17IN4O and a molecular weight of 444.28 g/mol. Its IUPAC name is N-[(E)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6882697 |
| Molecular Formula | C19H17IN4O |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | N-[(E)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2ccncc2)c(C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C19H17IN4O/c1-13-11-16(12-22-23-19(25)15-7-9-21-10-8-15)14(2)24(13)18-5-3-17(20)4-6-18/h3-12H,1-2H3,(H,23,25)/b22-12+ |
| InChIKey | NLGDLLQYFMAQRJ-WSDLNYQXSA-N |
| XLogP | 3.86 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|