C24H23BrN4O5 — CID 19061480
ethyl 4-[3-[(E)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-nitrobenzoate (PubChem CID 19061480) has the molecular formula C24H23BrN4O5 and a molecular weight of 527.38 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-nitrobenzoate.
| Compound Name | ethyl 4-[3-[(E)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 19061480 |
| Molecular Formula | C24H23BrN4O5 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | ethyl 4-[3-[(E)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=N/NC(=O)Cc3ccc(Br)cc3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23BrN4O5/c1-4-34-24(31)21-10-9-20(13-22(21)29(32)33)28-15(2)11-18(16(28)3)14-26-27-23(30)12-17-5-7-19(25)8-6-17/h5-11,13-14H,4,12H2,1-3H3,(H,27,30)/b26-14+ |
| InChIKey | IXIJTRHCQNIYKR-VULFUBBASA-N |
| XLogP | 4.63 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|