C22H12N2O5S — CID 118715330
2-[(3-nitrophenyl)methylsulfanyl]naphtho[2,3-f][1,3]benzoxazole-5,10-dione (PubChem CID 118715330) has the molecular formula C22H12N2O5S and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylsulfanyl]naphtho[2,3-f][1,3]benzoxazole-5,10-dione.
| Compound Name | 2-[(3-nitrophenyl)methylsulfanyl]naphtho[2,3-f][1,3]benzoxazole-5,10-dione |
|---|---|
| PubChem CID | 118715330 |
| Molecular Formula | C22H12N2O5S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-[(3-nitrophenyl)methylsulfanyl]naphtho[2,3-f][1,3]benzoxazole-5,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc3oc(SCc4cccc([N+](=O)[O-])c4)nc3cc21 |
| InChI | InChI=1S/C22H12N2O5S/c25-20-14-6-1-2-7-15(14)21(26)17-10-19-18(9-16(17)20)23-22(29-19)30-11-12-4-3-5-13(8-12)24(27)28/h1-10H,11H2 |
| InChIKey | WEFKMNUAWJYTMF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|