C21H16N2O6S2 — CID 122448292
N-[5-hydroxy-2-[(3-nitrophenyl)methylsulfanyl]phenyl]-1-benzofuran-2-sulfonamide (PubChem CID 122448292) has the molecular formula C21H16N2O6S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[5-hydroxy-2-[(3-nitrophenyl)methylsulfanyl]phenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-hydroxy-2-[(3-nitrophenyl)methylsulfanyl]phenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 122448292 |
| Molecular Formula | C21H16N2O6S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[5-hydroxy-2-[(3-nitrophenyl)methylsulfanyl]phenyl]-1-benzofuran-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cccc(CSc2ccc(O)cc2NS(=O)(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C21H16N2O6S2/c24-17-8-9-20(30-13-14-4-3-6-16(10-14)23(25)26)18(12-17)22-31(27,28)21-11-15-5-1-2-7-19(15)29-21/h1-12,22,24H,13H2 |
| InChIKey | SIEBDASMRBRBCF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|