C19H14ClN3O3S2 — CID 71728031
N-[5-chloro-2-(pyridin-3-ylmethylsulfanyl)-3-pyridinyl]-1-benzofuran-2-sulfonamide (PubChem CID 71728031) has the molecular formula C19H14ClN3O3S2 and a molecular weight of 431.93 g/mol. Its IUPAC name is N-[5-chloro-2-(pyridin-3-ylmethylsulfanyl)-3-pyridinyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-(pyridin-3-ylmethylsulfanyl)-3-pyridinyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 71728031 |
| Molecular Formula | C19H14ClN3O3S2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-[5-chloro-2-(pyridin-3-ylmethylsulfanyl)-3-pyridinyl]-1-benzofuran-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cnc1SCc1cccnc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H14ClN3O3S2/c20-15-9-16(19(22-11-15)27-12-13-4-3-7-21-10-13)23-28(24,25)18-8-14-5-1-2-6-17(14)26-18/h1-11,23H,12H2 |
| InChIKey | WSSPTLQCWDAOTB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |