C18H20N2O3S2 — CID 9322655
2-benzylsulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide (PubChem CID 9322655) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-benzylsulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 2-benzylsulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 9322655 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-benzylsulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2oc(SCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-3-20(4-2)25(21,22)15-10-11-17-16(12-15)19-18(23-17)24-13-14-8-6-5-7-9-14/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | GZGFZUJRDOLPHD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |