C15H18BrF3N2O3S2 — CID 19384241
2-(4-bromo-3,4,4-trifluorobutyl)sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide (PubChem CID 19384241) has the molecular formula C15H18BrF3N2O3S2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 2-(4-bromo-3,4,4-trifluorobutyl)sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 2-(4-bromo-3,4,4-trifluorobutyl)sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 19384241 |
| Molecular Formula | C15H18BrF3N2O3S2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 2-(4-bromo-3,4,4-trifluorobutyl)sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2oc(SCCC(F)C(F)(F)Br)nc2c1 |
| InChI | InChI=1S/C15H18BrF3N2O3S2/c1-3-21(4-2)26(22,23)10-5-6-12-11(9-10)20-14(24-12)25-8-7-13(17)15(16,18)19/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | OGCMORQHOPWBJG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|