C21H21ClN4O2S — CID 4828131
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one (PubChem CID 4828131) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one.
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4828131 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one |
| SMILES | CCOCCCn1c(SCc2cn3cc(Cl)ccc3n2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21ClN4O2S/c1-2-28-11-5-10-26-20(27)17-6-3-4-7-18(17)24-21(26)29-14-16-13-25-12-15(22)8-9-19(25)23-16/h3-4,6-9,12-13H,2,5,10-11,14H2,1H3 |
| InChIKey | QEFSASXEKANTET-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|