C24H21ClN4O4S — CID 137279500
2-[[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 137279500) has the molecular formula C24H21ClN4O4S and a molecular weight of 496.98 g/mol. Its IUPAC name is 2-[[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137279500 |
| Molecular Formula | C24H21ClN4O4S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-[[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | CCOCCCn1c(SCc2nc3c(oc4ccccc43)c(=O)[nH]2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C24H21ClN4O4S/c1-2-32-11-5-10-29-23(31)15-9-8-14(25)12-17(15)26-24(29)34-13-19-27-20-16-6-3-4-7-18(16)33-21(20)22(30)28-19/h3-4,6-9,12H,2,5,10-11,13H2,1H3,(H,27,28,30) |
| InChIKey | RLNBPTYHIHDPCX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|