C20H25ClN4O3S — CID 55584960
7-chloro-3-(3-ethoxypropyl)-2-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 55584960) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is 7-chloro-3-(3-ethoxypropyl)-2-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-ethoxypropyl)-2-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55584960 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 7-chloro-3-(3-ethoxypropyl)-2-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | CCOCCCn1c(SCc2noc(CC(C)C)n2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H25ClN4O3S/c1-4-27-9-5-8-25-19(26)15-7-6-14(21)11-16(15)22-20(25)29-12-17-23-18(28-24-17)10-13(2)3/h6-7,11,13H,4-5,8-10,12H2,1-3H3 |
| InChIKey | SGUQPSYFMHSVKK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|