C24H35N3O3S2 — CID 25489328
2-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 25489328) has the molecular formula C24H35N3O3S2 and a molecular weight of 477.70 g/mol. Its IUPAC name is 2-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 25489328 |
| Molecular Formula | C24H35N3O3S2 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOCCCn1c(SCC(=O)N2CCC[C@@H]3CCCC[C@H]32)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C24H35N3O3S2/c1-4-30-14-8-13-27-23(29)21-16(2)17(3)32-22(21)25-24(27)31-15-20(28)26-12-7-10-18-9-5-6-11-19(18)26/h18-19H,4-15H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | DTSBABZAZZPEFP-RBUKOAKNSA-N |
| XLogP | 4.77 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|