C22H14FN5O4S2 — CID 4790684
5-(4-fluorophenyl)-3-methyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 4790684) has the molecular formula C22H14FN5O4S2 and a molecular weight of 495.52 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-methyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-fluorophenyl)-3-methyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4790684 |
| Molecular Formula | C22H14FN5O4S2 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 5-(4-fluorophenyl)-3-methyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(SCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)nc2scc(-c3ccc(F)cc3)c2c1=O |
| InChI | InChI=1S/C22H14FN5O4S2/c1-27-21(29)18-16(12-2-6-14(23)7-3-12)10-33-20(18)24-22(27)34-11-17-25-26-19(32-17)13-4-8-15(9-5-13)28(30)31/h2-10H,11H2,1H3 |
| InChIKey | DPEMNSBUNOEYCO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|