C23H23N5O3S — CID 171934279
1-(4-methylphenyl)-2-[(8-nitro-5-pentyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone (PubChem CID 171934279) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[(8-nitro-5-pentyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(4-methylphenyl)-2-[(8-nitro-5-pentyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 171934279 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-(4-methylphenyl)-2-[(8-nitro-5-pentyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
| SMILES | CCCCCn1c2ccc([N+](=O)[O-])cc2c2nnc(SCC(=O)c3ccc(C)cc3)nc21 |
| InChI | InChI=1S/C23H23N5O3S/c1-3-4-5-12-27-19-11-10-17(28(30)31)13-18(19)21-22(27)24-23(26-25-21)32-14-20(29)16-8-6-15(2)7-9-16/h6-11,13H,3-5,12,14H2,1-2H3 |
| InChIKey | QRQYNGABQHZJLM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|