C18H24N6O4S — CID 18199509
2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 18199509) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18199509 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | CC(C)Cn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nnc1N1CCOCC1 |
| InChI | InChI=1S/C18H24N6O4S/c1-13(2)11-23-17(22-7-9-28-10-8-22)20-21-18(23)29-12-16(25)19-14-3-5-15(6-4-14)24(26)27/h3-6,13H,7-12H2,1-2H3,(H,19,25) |
| InChIKey | CVWIHVIKMGARLO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|