C25H19N5O4S — CID 39066309
3-(2,5-dimethylphenyl)-2-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 39066309) has the molecular formula C25H19N5O4S and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(2,5-dimethylphenyl)-2-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 39066309 |
| Molecular Formula | C25H19N5O4S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccc(C)c(-n2c(SCc3nc(-c4cccc([N+](=O)[O-])c4)no3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H19N5O4S/c1-15-10-11-16(2)21(12-15)29-24(31)19-8-3-4-9-20(19)26-25(29)35-14-22-27-23(28-34-22)17-6-5-7-18(13-17)30(32)33/h3-13H,14H2,1-2H3 |
| InChIKey | XNCLMCDIDATWPD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|