C22H19NO5S — CID 7848426
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate (PubChem CID 7848426) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
|---|---|
| PubChem CID | 7848426 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc4c(c3)NC(=O)CCS4)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H19NO5S/c1-12-3-5-16-15(10-20(25)28-21(16)13(12)2)11-27-22(26)14-4-6-18-17(9-14)23-19(24)7-8-29-18/h3-6,9-10H,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | PGDDYXYZNJEHBP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|