C25H25Cl2N3O6 — CID 21168592
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21168592) has the molecular formula C25H25Cl2N3O6 and a molecular weight of 534.40 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168592 |
| Molecular Formula | C25H25Cl2N3O6 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(NCCN3CCOCC3)C2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O6/c26-19-6-3-17(13-20(19)27)22(31)15-36-25(34)16-1-4-18(5-2-16)30-23(32)14-21(24(30)33)28-7-8-29-9-11-35-12-10-29/h1-6,13,21,28H,7-12,14-15H2 |
| InChIKey | DPEGRYBUDUEJDH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|