C25H29N3O5 — CID 27890675
methyl 4-[(3R)-3-[4-(4-ethoxyanilino)piperidin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 27890675) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 4-[(3R)-3-[4-(4-ethoxyanilino)piperidin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3R)-3-[4-(4-ethoxyanilino)piperidin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 27890675 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl 4-[(3R)-3-[4-(4-ethoxyanilino)piperidin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(NC2CCN([C@@H]3CC(=O)N(c4ccc(C(=O)OC)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-3-33-21-10-6-18(7-11-21)26-19-12-14-27(15-13-19)22-16-23(29)28(24(22)30)20-8-4-17(5-9-20)25(31)32-2/h4-11,19,22,26H,3,12-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | DMOBRLCLFXRDPZ-JOCHJYFZSA-N |
| XLogP | 3.08 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|