C28H39N3O6 — CID 26413241
ethyl 4-[1-[(3R)-1-(4-butoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 26413241) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is ethyl 4-[1-[(3R)-1-(4-butoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[1-[(3R)-1-(4-butoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 26413241 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | ethyl 4-[1-[(3R)-1-(4-butoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)C[C@@H](N3CCC(C4CCN(C(=O)OCC)CC4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C28H39N3O6/c1-3-5-18-37-27(34)22-6-8-23(9-7-22)31-25(32)19-24(26(31)33)29-14-10-20(11-15-29)21-12-16-30(17-13-21)28(35)36-4-2/h6-9,20-21,24H,3-5,10-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | OWKKIVXWFQEHHJ-XMMPIXPASA-N |
| XLogP | 3.86 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|