C23H28N2O4 — CID 98077941
butyl 4-[(3S)-3-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 98077941) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is butyl 4-[(3S)-3-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | butyl 4-[(3S)-3-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 98077941 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | butyl 4-[(3S)-3-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)C[C@H](N3C[C@H]4CC=CC[C@H]4C3)C2=O)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-3-12-29-23(28)16-8-10-19(11-9-16)25-21(26)13-20(22(25)27)24-14-17-6-4-5-7-18(17)15-24/h4-5,8-11,17-18,20H,2-3,6-7,12-15H2,1H3/t17-,18+,20-/m0/s1 |
| InChIKey | NOYMGFWJBOBOLC-NSHGMRRFSA-N |
| XLogP | 3.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|