C17H22N3O3+ — CID 6923629
N-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetamide (PubChem CID 6923629) has the molecular formula C17H22N3O3+ and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6923629 |
| Molecular Formula | C17H22N3O3+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C[C@@H]([NH+]3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-12(21)18-13-5-7-14(8-6-13)20-16(22)11-15(17(20)23)19-9-3-2-4-10-19/h5-8,15H,2-4,9-11H2,1H3,(H,18,21)/p+1/t15-/m1/s1 |
| InChIKey | RRXPLPUVGDBFRX-OAHLLOKOSA-O |
| XLogP | 0.35 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|