C18H24N3O4+ — CID 7216034
N-[4-[(3R)-3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 7216034) has the molecular formula C18H24N3O4+ and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[4-[(3R)-3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3R)-3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 7216034 |
| Molecular Formula | C18H24N3O4+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[4-[(3R)-3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C[C@@H]([NH+]3C[C@@H](C)O[C@@H](C)C3)C2=O)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-11-9-20(10-12(2)25-11)16-8-17(23)21(18(16)24)15-6-4-14(5-7-15)19-13(3)22/h4-7,11-12,16H,8-10H2,1-3H3,(H,19,22)/p+1/t11-,12+,16-/m1/s1 |
| InChIKey | KKTGZRNDWLAPHX-BFQNTYOBSA-O |
| XLogP | -0.03 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|