C20H28N3O3+ — CID 11906208
[(3R)-1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-[(1R,2R,3S)-2,3-dimethylcyclohexyl]azanium (PubChem CID 11906208) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is [(3R)-1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-[(1R,2R,3S)-2,3-dimethylcyclohexyl]azanium.
| Compound Name | [(3R)-1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-[(1R,2R,3S)-2,3-dimethylcyclohexyl]azanium |
|---|---|
| PubChem CID | 11906208 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(3R)-1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-[(1R,2R,3S)-2,3-dimethylcyclohexyl]azanium |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C[C@@H]([NH2+][C@@H]3CCC[C@H](C)[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-12-5-4-6-17(13(12)2)22-18-11-19(25)23(20(18)26)16-9-7-15(8-10-16)21-14(3)24/h7-10,12-13,17-18,22H,4-6,11H2,1-3H3,(H,21,24)/p+1/t12-,13+,17+,18+/m0/s1 |
| InChIKey | AZTKASKUVGNYGP-QIZIZJAASA-O |
| XLogP | 1.66 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|