C18H25N2O3+ — CID 7471061
[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(1S,2R)-2-methylcyclohexyl]azanium (PubChem CID 7471061) has the molecular formula C18H25N2O3+ and a molecular weight of 317.41 g/mol. Its IUPAC name is [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(1S,2R)-2-methylcyclohexyl]azanium.
| Compound Name | [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(1S,2R)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 7471061 |
| Molecular Formula | C18H25N2O3+ |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(1S,2R)-2-methylcyclohexyl]azanium |
| SMILES | COc1ccc(N2C(=O)C[C@@H]([NH2+][C@H]3CCCC[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-5-3-4-6-15(12)19-16-11-17(21)20(18(16)22)13-7-9-14(23-2)10-8-13/h7-10,12,15-16,19H,3-6,11H2,1-2H3/p+1/t12-,15+,16-/m1/s1 |
| InChIKey | ARLKMDVDFKBXPW-UHOFOFEASA-O |
| XLogP | 1.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|