C22H28N5O3+ — CID 7353317
[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7353317) has the molecular formula C22H28N5O3+ and a molecular weight of 410.50 g/mol. Its IUPAC name is [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7353317 |
| Molecular Formula | C22H28N5O3+ |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | COc1ccc(N2C(=O)C[C@@H]([NH2+]C3CCN(c4cc(C)nc(C)n4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H27N5O3/c1-14-12-20(24-15(2)23-14)26-10-8-16(9-11-26)25-19-13-21(28)27(22(19)29)17-4-6-18(30-3)7-5-17/h4-7,12,16,19,25H,8-11,13H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | NHCUJEZIPLIHQR-LJQANCHMSA-O |
| XLogP | 0.97 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|