C23H24FN3O5S — CID 23970773
N-[4-[3-[cyclopentyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 23970773) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[4-[3-[cyclopentyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[cyclopentyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23970773 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[4-[3-[cyclopentyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(C3CCCC3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H24FN3O5S/c1-15(28)25-17-8-10-18(11-9-17)26-22(29)14-21(23(26)30)27(19-4-2-3-5-19)33(31,32)20-12-6-16(24)7-13-20/h6-13,19,21H,2-5,14H2,1H3,(H,25,28) |
| InChIKey | SLNJJNGPXZMXIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|