C24H23NO8S — CID 23098470
[2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23098470) has the molecular formula C24H23NO8S and a molecular weight of 485.51 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23098470 |
| Molecular Formula | C24H23NO8S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)CSC1CC(=O)N(c2ccc(C(=O)OCC(=O)c3cccc(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C24H23NO8S/c1-3-32-22(28)14-34-20-12-21(27)25(23(20)29)17-9-7-15(8-10-17)24(30)33-13-19(26)16-5-4-6-18(11-16)31-2/h4-11,20H,3,12-14H2,1-2H3 |
| InChIKey | ZDVAPLYKAMDKAT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|