C24H18ClNO6S — CID 23098314
[2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23098314) has the molecular formula C24H18ClNO6S and a molecular weight of 483.93 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23098314 |
| Molecular Formula | C24H18ClNO6S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(OCC(=O)c1ccccc1Cl)c1ccc(N2C(=O)CC(SCc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C24H18ClNO6S/c25-19-6-2-1-5-18(19)20(27)13-32-24(30)15-7-9-16(10-8-15)26-22(28)12-21(23(26)29)33-14-17-4-3-11-31-17/h1-11,21H,12-14H2 |
| InChIKey | OINQBCRYXACYNO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|