C31H23NO6S — CID 21168836
[2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21168836) has the molecular formula C31H23NO6S and a molecular weight of 537.59 g/mol. Its IUPAC name is [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168836 |
| Molecular Formula | C31H23NO6S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[3-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(SCc3ccco3)C2=O)cc1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C31H23NO6S/c33-27(21-9-12-26-22(15-21)14-20-4-1-2-6-25(20)26)17-38-31(36)19-7-10-23(11-8-19)32-29(34)16-28(30(32)35)39-18-24-5-3-13-37-24/h1-13,15,28H,14,16-18H2 |
| InChIKey | VSKJDCZNMHZYLV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|