C14H19BrN2O3 — CID 43409185
ethyl 1-(4-bromo-1-methylpyrrole-2-carbonyl)piperidine-3-carboxylate (PubChem CID 43409185) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is ethyl 1-(4-bromo-1-methylpyrrole-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-bromo-1-methylpyrrole-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43409185 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | ethyl 1-(4-bromo-1-methylpyrrole-2-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(Br)cn2C)C1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-3-20-14(19)10-5-4-6-17(8-10)13(18)12-7-11(15)9-16(12)2/h7,9-10H,3-6,8H2,1-2H3 |
| InChIKey | XXRNFOSWNBOIEB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |