C13H19N3O3 — CID 43664914
ethyl 1-(2-methylpyrazole-3-carbonyl)piperidine-3-carboxylate (PubChem CID 43664914) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 1-(2-methylpyrazole-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2-methylpyrazole-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43664914 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | ethyl 1-(2-methylpyrazole-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccnn2C)C1 |
| InChI | InChI=1S/C13H19N3O3/c1-3-19-13(18)10-5-4-8-16(9-10)12(17)11-6-7-14-15(11)2/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | OZEIFOMBHYTLRD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |