C20H25BrN2O4 — CID 46109661
ethyl 1-[1-[(3-bromophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 46109661) has the molecular formula C20H25BrN2O4 and a molecular weight of 437.33 g/mol. Its IUPAC name is ethyl 1-[1-[(3-bromophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-[(3-bromophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46109661 |
| Molecular Formula | C20H25BrN2O4 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | ethyl 1-[1-[(3-bromophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CC(=O)N(Cc3cccc(Br)c3)C2)C1 |
| InChI | InChI=1S/C20H25BrN2O4/c1-2-27-20(26)15-6-4-8-22(12-15)19(25)16-10-18(24)23(13-16)11-14-5-3-7-17(21)9-14/h3,5,7,9,15-16H,2,4,6,8,10-13H2,1H3 |
| InChIKey | DJHGIXMLEHXMBG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |