C20H25FN2O4 — CID 46109609
ethyl 1-[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 46109609) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is ethyl 1-[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46109609 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl 1-[1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CC(=O)N(Cc3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C20H25FN2O4/c1-2-27-20(26)15-4-3-9-22(12-15)19(25)16-10-18(24)23(13-16)11-14-5-7-17(21)8-6-14/h5-8,15-16H,2-4,9-13H2,1H3 |
| InChIKey | RFIHYSPLLVBMMW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |