C18H28N2O4 — CID 9364684
ethyl (3S)-1-[(3S)-1-cyclopentyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 9364684) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl (3S)-1-[(3S)-1-cyclopentyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(3S)-1-cyclopentyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 9364684 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | ethyl (3S)-1-[(3S)-1-cyclopentyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)[C@H]2CC(=O)N(C3CCCC3)C2)C1 |
| InChI | InChI=1S/C18H28N2O4/c1-2-24-18(23)13-6-5-9-19(11-13)17(22)14-10-16(21)20(12-14)15-7-3-4-8-15/h13-15H,2-12H2,1H3/t13-,14-/m0/s1 |
| InChIKey | YTKPMPVTKGMKAG-KBPBESRZSA-N |
| XLogP | 1.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |