C19H30N2O4 — CID 93018625
ethyl (3R)-1-[(3S)-1-cyclohexyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 93018625) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl (3R)-1-[(3S)-1-cyclohexyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3S)-1-cyclohexyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93018625 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | ethyl (3R)-1-[(3S)-1-cyclohexyl-5-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)[C@H]2CC(=O)N(C3CCCCC3)C2)C1 |
| InChI | InChI=1S/C19H30N2O4/c1-2-25-19(24)14-7-6-10-20(12-14)18(23)15-11-17(22)21(13-15)16-8-4-3-5-9-16/h14-16H,2-13H2,1H3/t14-,15+/m1/s1 |
| InChIKey | GJLXBIIPHPSWKC-CABCVRRESA-N |
| XLogP | 1.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |