C15H24N2O4 — CID 43424047
ethyl 1-(1-ethyl-5-oxopyrrolidine-3-carbonyl)piperidine-3-carboxylate (PubChem CID 43424047) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 1-(1-ethyl-5-oxopyrrolidine-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(1-ethyl-5-oxopyrrolidine-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43424047 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | ethyl 1-(1-ethyl-5-oxopyrrolidine-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CC(=O)N(CC)C2)C1 |
| InChI | InChI=1S/C15H24N2O4/c1-3-16-10-12(8-13(16)18)14(19)17-7-5-6-11(9-17)15(20)21-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | DVXLHDKOSGAVEZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |